C17H25N3O2S — CID 119562177
N-[4-[1-[4-(methylamino)piperidin-1-yl]-1-oxopropan-2-yl]sulfanylphenyl]acetamide (PubChem CID 119562177) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[4-[1-[4-(methylamino)piperidin-1-yl]-1-oxopropan-2-yl]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[1-[4-(methylamino)piperidin-1-yl]-1-oxopropan-2-yl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 119562177 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-[4-[1-[4-(methylamino)piperidin-1-yl]-1-oxopropan-2-yl]sulfanylphenyl]acetamide |
| SMILES | CNC1CCN(C(=O)C(C)Sc2ccc(NC(C)=O)cc2)CC1 |
| InChI | InChI=1S/C17H25N3O2S/c1-12(17(22)20-10-8-14(18-3)9-11-20)23-16-6-4-15(5-7-16)19-13(2)21/h4-7,12,14,18H,8-11H2,1-3H3,(H,19,21) |
| InChIKey | ASTSPRFZPSAMMF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |