C29H24F6N4O2 — CID 11956230
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[methyl(naphthalene-1-carbonyl)amino]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 11956230) has the molecular formula C29H24F6N4O2 and a molecular weight of 574.53 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[methyl(naphthalene-1-carbonyl)amino]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[methyl(naphthalene-1-carbonyl)amino]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11956230 |
| Molecular Formula | C29H24F6N4O2 |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[methyl(naphthalene-1-carbonyl)amino]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CN(C(=O)c1cccc2ccccc12)c1nc2n(c1C(=O)NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)CCCC2 |
| InChI | InChI=1S/C29H24F6N4O2/c1-38(27(41)22-10-6-8-18-7-2-3-9-21(18)22)25-24(39-12-5-4-11-23(39)37-25)26(40)36-16-17-13-19(28(30,31)32)15-20(14-17)29(33,34)35/h2-3,6-10,13-15H,4-5,11-12,16H2,1H3,(H,36,40) |
| InChIKey | YZCMQLCGCVGLDM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |