C26H32N2O — CID 11956286
N,N,3,6-tetramethyl-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine (PubChem CID 11956286) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is N,N,3,6-tetramethyl-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine.
| Compound Name | N,N,3,6-tetramethyl-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine |
|---|---|
| PubChem CID | 11956286 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N,N,3,6-tetramethyl-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CC(C)OC31CCC(c2ccccc2)(N(C)C)CC1 |
| InChI | InChI=1S/C26H32N2O/c1-18-10-11-23-21(16-18)22-17-19(2)29-26(24(22)27-23)14-12-25(13-15-26,28(3)4)20-8-6-5-7-9-20/h5-11,16,19,27H,12-15,17H2,1-4H3 |
| InChIKey | FJCNUXXAHZVGIR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |