C23H26N4OS — CID 11956321
1-(2-methylthieno[2,3-c]pyridin-3-yl)-3-(5-piperidin-1-yl-2,3-dihydro-1H-inden-1-yl)urea (PubChem CID 11956321) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is 1-(2-methylthieno[2,3-c]pyridin-3-yl)-3-(5-piperidin-1-yl-2,3-dihydro-1H-inden-1-yl)urea.
| Compound Name | 1-(2-methylthieno[2,3-c]pyridin-3-yl)-3-(5-piperidin-1-yl-2,3-dihydro-1H-inden-1-yl)urea |
|---|---|
| PubChem CID | 11956321 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-(2-methylthieno[2,3-c]pyridin-3-yl)-3-(5-piperidin-1-yl-2,3-dihydro-1H-inden-1-yl)urea |
| SMILES | Cc1sc2cnccc2c1NC(=O)NC1CCc2cc(N3CCCCC3)ccc21 |
| InChI | InChI=1S/C23H26N4OS/c1-15-22(19-9-10-24-14-21(19)29-15)26-23(28)25-20-8-5-16-13-17(6-7-18(16)20)27-11-3-2-4-12-27/h6-7,9-10,13-14,20H,2-5,8,11-12H2,1H3,(H2,25,26,28) |
| InChIKey | RNYUVQTVSVZLHW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|