About 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one
2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one (PubChem CID 11956322) has the molecular formula C22H18N2O3S
and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one |
| PubChem CID | 11956322 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one |
| SMILES | O=c1cc(N2CCOCC2)oc2c(-c3cccc(-c4nccs4)c3)cccc12 |
| InChI | InChI=1S/C22H18N2O3S/c25-19-14-20(24-8-10-26-11-9-24)27-21-17(5-2-6-18(19)21)15-3-1-4-16(13-15)22-23-7-12-28-22/h1-7,12-14H,8-11H2 |
| InChIKey | GXLBLWPNGBQINY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one?
The IUPAC name of 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one (CID 11956322) is 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one.
What is the SMILES notation for 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one?
The canonical SMILES for 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one is O=c1cc(N2CCOCC2)oc2c(-c3cccc(-c4nccs4)c3)cccc12.
What is the InChIKey of 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one?
The InChIKey is GXLBLWPNGBQINY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O3S/c25-19-14-20(24-8-10-26-11-9-24)27-21-17(5-2-6-18(19)21)15-3-1-4-16(13-15)22-23-7-12-28-22/h1-7,12-14H,8-11H2.
What are the key properties of 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one?
2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one has a molecular weight of 390.46 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-8-[3-(1,3-thiazol-2-yl)phenyl]chromen-4-one is sourced from PubChem (CID 11956322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).