C14H20BrClN2O — CID 119563275
(3-bromo-4-methylphenyl)-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119563275) has the molecular formula C14H20BrClN2O and a molecular weight of 347.68 g/mol. Its IUPAC name is (3-bromo-4-methylphenyl)-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (3-bromo-4-methylphenyl)-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119563275 |
| Molecular Formula | C14H20BrClN2O |
| Molecular Weight | 347.68 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | (3-bromo-4-methylphenyl)-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNC1CCN(C(=O)c2ccc(C)c(Br)c2)CC1.Cl |
| InChI | InChI=1S/C14H19BrN2O.ClH/c1-10-3-4-11(9-13(10)15)14(18)17-7-5-12(16-2)6-8-17;/h3-4,9,12,16H,5-8H2,1-2H3;1H |
| InChIKey | VIBAFFMBSXXBGJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.68 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |