C14H21N5O2 — CID 11956362
1-[4-amino-2-[(E)-methoxyiminomethyl]-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-2-methylpropan-2-ol (PubChem CID 11956362) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 1-[4-amino-2-[(E)-methoxyiminomethyl]-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-amino-2-[(E)-methoxyiminomethyl]-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 11956362 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-[4-amino-2-[(E)-methoxyiminomethyl]-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-2-methylpropan-2-ol |
| SMILES | CO/N=C/c1nc2c(N)nc(C)c(C)c2n1CC(C)(C)O |
| InChI | InChI=1S/C14H21N5O2/c1-8-9(2)17-13(15)11-12(8)19(7-14(3,4)20)10(18-11)6-16-21-5/h6,20H,7H2,1-5H3,(H2,15,17)/b16-6+ |
| InChIKey | NFBDERSDGOKWEL-OMCISZLKSA-N |
| XLogP | 1.38 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|