C12H19Cl2N3O — CID 119563732
(4-chloro-1-methylpyrrol-2-yl)-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119563732) has the molecular formula C12H19Cl2N3O and a molecular weight of 292.21 g/mol. Its IUPAC name is (4-chloro-1-methylpyrrol-2-yl)-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (4-chloro-1-methylpyrrol-2-yl)-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119563732 |
| Molecular Formula | C12H19Cl2N3O |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (4-chloro-1-methylpyrrol-2-yl)-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNC1CCN(C(=O)c2cc(Cl)cn2C)CC1.Cl |
| InChI | InChI=1S/C12H18ClN3O.ClH/c1-14-10-3-5-16(6-4-10)12(17)11-7-9(13)8-15(11)2;/h7-8,10,14H,3-6H2,1-2H3;1H |
| InChIKey | HHXZVYHFEDYPEV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |