C18H22ClN3O2 — CID 119564155
[4-[4-(methylamino)piperidine-1-carbonyl]phenyl]-(1H-pyrrol-3-yl)methanone;hydrochloride (PubChem CID 119564155) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is [4-[4-(methylamino)piperidine-1-carbonyl]phenyl]-(1H-pyrrol-3-yl)methanone;hydrochloride.
| Compound Name | [4-[4-(methylamino)piperidine-1-carbonyl]phenyl]-(1H-pyrrol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119564155 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | [4-[4-(methylamino)piperidine-1-carbonyl]phenyl]-(1H-pyrrol-3-yl)methanone;hydrochloride |
| SMILES | CNC1CCN(C(=O)c2ccc(C(=O)c3cc[nH]c3)cc2)CC1.Cl |
| InChI | InChI=1S/C18H21N3O2.ClH/c1-19-16-7-10-21(11-8-16)18(23)14-4-2-13(3-5-14)17(22)15-6-9-20-12-15;/h2-6,9,12,16,19-20H,7-8,10-11H2,1H3;1H |
| InChIKey | AWAZLVRIXSTLFJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |