About (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride
(3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride (PubChem CID 119564341) has the molecular formula C12H20Cl2N4O
and a molecular weight of 307.23 g/mol. Its IUPAC name is (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride.
Molecular Properties
| Compound Name | (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride |
| PubChem CID | 119564341 |
| Molecular Formula | C12H20Cl2N4O |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride |
| SMILES | Cc1cnc(C(=O)N2CC(C)NC(C)C2)cn1.Cl.Cl |
| InChI | InChI=1S/C12H18N4O.2ClH/c1-8-4-14-11(5-13-8)12(17)16-6-9(2)15-10(3)7-16;;/h4-5,9-10,15H,6-7H2,1-3H3;2*1H |
| InChIKey | IGROYNGHCXRNRY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride?
The IUPAC name of (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride (CID 119564341) is (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride.
What is the SMILES notation for (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride?
The canonical SMILES for (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride is Cc1cnc(C(=O)N2CC(C)NC(C)C2)cn1.Cl.Cl.
What is the InChIKey of (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride?
The InChIKey is IGROYNGHCXRNRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O.2ClH/c1-8-4-14-11(5-13-8)12(17)16-6-9(2)15-10(3)7-16;;/h4-5,9-10,15H,6-7H2,1-3H3;2*1H.
What are the key properties of (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride?
(3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride has a molecular weight of 307.23 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylpiperazin-1-yl)-(5-methylpyrazin-2-yl)methanone;dihydrochloride is sourced from PubChem (CID 119564341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).