C18H28ClN3O4S — CID 119565502
N-[1-(aminomethyl)cyclopentyl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide;hydrochloride (PubChem CID 119565502) has the molecular formula C18H28ClN3O4S and a molecular weight of 417.96 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119565502 |
| Molecular Formula | C18H28ClN3O4S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide;hydrochloride |
| SMILES | Cl.NCC1(NC(=O)c2ccc(S(=O)(=O)NCC3CCCO3)cc2)CCCC1 |
| InChI | InChI=1S/C18H27N3O4S.ClH/c19-13-18(9-1-2-10-18)21-17(22)14-5-7-16(8-6-14)26(23,24)20-12-15-4-3-11-25-15;/h5-8,15,20H,1-4,9-13,19H2,(H,21,22);1H |
| InChIKey | BWYSIHIHUWRGLD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |