C18H21N3O3S — CID 119566451
N-[1-(aminomethyl)cyclopentyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide (PubChem CID 119566451) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide |
|---|---|
| PubChem CID | 119566451 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide |
| SMILES | NCC1(NC(=O)CN2c3cccc4cccc(c34)S2(=O)=O)CCCC1 |
| InChI | InChI=1S/C18H21N3O3S/c19-12-18(9-1-2-10-18)20-16(22)11-21-14-7-3-5-13-6-4-8-15(17(13)14)25(21,23)24/h3-8H,1-2,9-12,19H2,(H,20,22) |
| InChIKey | XWFQNHLCDWFYQM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |