C12H18Cl3N3O — CID 119566570
N-[1-(aminomethyl)cyclopentyl]-5-chloropyridine-2-carboxamide;dihydrochloride (PubChem CID 119566570) has the molecular formula C12H18Cl3N3O and a molecular weight of 326.66 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-5-chloropyridine-2-carboxamide;dihydrochloride.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-5-chloropyridine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119566570 |
| Molecular Formula | C12H18Cl3N3O |
| Molecular Weight | 326.66 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-5-chloropyridine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCC1(NC(=O)c2ccc(Cl)cn2)CCCC1 |
| InChI | InChI=1S/C12H16ClN3O.2ClH/c13-9-3-4-10(15-7-9)11(17)16-12(8-14)5-1-2-6-12;;/h3-4,7H,1-2,5-6,8,14H2,(H,16,17);2*1H |
| InChIKey | ISRMEWSZWQKUGE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.66 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |