C13H20ClN3O2 — CID 119566853
N-[1-(aminomethyl)cyclopentyl]-2-(2-oxo-1-pyridinyl)acetamide;hydrochloride (PubChem CID 119566853) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-2-(2-oxo-1-pyridinyl)acetamide;hydrochloride.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-2-(2-oxo-1-pyridinyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119566853 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-2-(2-oxo-1-pyridinyl)acetamide;hydrochloride |
| SMILES | Cl.NCC1(NC(=O)Cn2ccccc2=O)CCCC1 |
| InChI | InChI=1S/C13H19N3O2.ClH/c14-10-13(6-2-3-7-13)15-11(17)9-16-8-4-1-5-12(16)18;/h1,4-5,8H,2-3,6-7,9-10,14H2,(H,15,17);1H |
| InChIKey | PPHQLXLPYAHDNX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |