C31H34FN3O6 — CID 11956771
N-(4-fluorophenyl)-1-[(2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]-4-phenyl-2-propan-2-yl-5-pyridin-4-ylpyrrole-3-carboxamide (PubChem CID 11956771) has the molecular formula C31H34FN3O6 and a molecular weight of 563.63 g/mol. Its IUPAC name is N-(4-fluorophenyl)-1-[(2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]-4-phenyl-2-propan-2-yl-5-pyridin-4-ylpyrrole-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-1-[(2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]-4-phenyl-2-propan-2-yl-5-pyridin-4-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 11956771 |
| Molecular Formula | C31H34FN3O6 |
| Molecular Weight | 563.63 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | N-(4-fluorophenyl)-1-[(2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]-4-phenyl-2-propan-2-yl-5-pyridin-4-ylpyrrole-3-carboxamide |
| SMILES | CC(C)c1c(C(=O)Nc2ccc(F)cc2)c(-c2ccccc2)c(-c2ccncc2)n1C[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C31H34FN3O6/c1-18(2)27-26(31(41)34-22-10-8-21(32)9-11-22)25(19-6-4-3-5-7-19)28(20-12-14-33-15-13-20)35(27)16-23(37)29(39)30(40)24(38)17-36/h3-15,18,23-24,29-30,36-40H,16-17H2,1-2H3,(H,34,41)/t23-,24-,29+,30+/m0/s1 |
| InChIKey | KTFKMUWTJSRHGB-BAAZAXTHSA-N |
| XLogP | 3.17 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |