C13H17ClFIN2O — CID 119567983
N-[1-(aminomethyl)cyclopentyl]-3-fluoro-4-iodobenzamide;hydrochloride (PubChem CID 119567983) has the molecular formula C13H17ClFIN2O and a molecular weight of 398.65 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-3-fluoro-4-iodobenzamide;hydrochloride.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-3-fluoro-4-iodobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119567983 |
| Molecular Formula | C13H17ClFIN2O |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-3-fluoro-4-iodobenzamide;hydrochloride |
| SMILES | Cl.NCC1(NC(=O)c2ccc(I)c(F)c2)CCCC1 |
| InChI | InChI=1S/C13H16FIN2O.ClH/c14-10-7-9(3-4-11(10)15)12(18)17-13(8-16)5-1-2-6-13;/h3-4,7H,1-2,5-6,8,16H2,(H,17,18);1H |
| InChIKey | MVDAGERAEJYVBK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|