C15H13ClO2 — CID 11956941
(1S,12R)-10-chloro-5-hydroxytetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraen-11-one (PubChem CID 11956941) has the molecular formula C15H13ClO2 and a molecular weight of 260.72 g/mol. Its IUPAC name is (1S,12R)-10-chloro-5-hydroxytetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraen-11-one.
| Compound Name | (1S,12R)-10-chloro-5-hydroxytetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraen-11-one |
|---|---|
| PubChem CID | 11956941 |
| Molecular Formula | C15H13ClO2 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (1S,12R)-10-chloro-5-hydroxytetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraen-11-one |
| SMILES | O=C1C(Cl)=C2c3ccc(O)cc3C[C@@]23CC[C@@H]1C3 |
| InChI | InChI=1S/C15H13ClO2/c16-13-12-11-2-1-10(17)5-9(11)7-15(12)4-3-8(6-15)14(13)18/h1-2,5,8,17H,3-4,6-7H2/t8-,15+/m1/s1 |
| InChIKey | SRPACXNDPSYBEE-GLEZIHRCSA-N |
| XLogP | 3.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|