About N-methyl-N-phenylnitrous amide
N-methyl-N-phenylnitrous amide (PubChem CID 11957) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is N-methyl-N-phenylnitrous amide.
Molecular Properties
| Compound Name | N-methyl-N-phenylnitrous amide |
| PubChem CID | 11957 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | N-methyl-N-phenylnitrous amide |
| SMILES | CN(N=O)c1ccccc1 |
| InChI | InChI=1S/C7H8N2O/c1-9(8-10)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | MAXCWSIJKVASQC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-phenylnitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-phenylnitrous amide?
The IUPAC name of N-methyl-N-phenylnitrous amide (CID 11957) is N-methyl-N-phenylnitrous amide.
What is the SMILES notation for N-methyl-N-phenylnitrous amide?
The canonical SMILES for N-methyl-N-phenylnitrous amide is CN(N=O)c1ccccc1.
What is the InChIKey of N-methyl-N-phenylnitrous amide?
The InChIKey is MAXCWSIJKVASQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c1-9(8-10)7-5-3-2-4-6-7/h2-6H,1H3.
What are the key properties of N-methyl-N-phenylnitrous amide?
N-methyl-N-phenylnitrous amide has a molecular weight of 136.15 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-phenylnitrous amide is sourced from PubChem (CID 11957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).