C23H22ClN5O — CID 11957078
7-chloro-N,N,9-trimethyl-2-(5,6,7,8-tetrahydroquinolin-3-yl)pyrimido[4,5-b]indole-4-carboxamide (PubChem CID 11957078) has the molecular formula C23H22ClN5O and a molecular weight of 419.92 g/mol. Its IUPAC name is 7-chloro-N,N,9-trimethyl-2-(5,6,7,8-tetrahydroquinolin-3-yl)pyrimido[4,5-b]indole-4-carboxamide.
| Compound Name | 7-chloro-N,N,9-trimethyl-2-(5,6,7,8-tetrahydroquinolin-3-yl)pyrimido[4,5-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 11957078 |
| Molecular Formula | C23H22ClN5O |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 7-chloro-N,N,9-trimethyl-2-(5,6,7,8-tetrahydroquinolin-3-yl)pyrimido[4,5-b]indole-4-carboxamide |
| SMILES | CN(C)C(=O)c1nc(-c2cnc3c(c2)CCCC3)nc2c1c1ccc(Cl)cc1n2C |
| InChI | InChI=1S/C23H22ClN5O/c1-28(2)23(30)20-19-16-9-8-15(24)11-18(16)29(3)22(19)27-21(26-20)14-10-13-6-4-5-7-17(13)25-12-14/h8-12H,4-7H2,1-3H3 |
| InChIKey | NBJBHCYSMNXKIV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |