C18H30ClN3O2 — CID 119571395
3-acetamido-N-[3-(aminomethyl)pentan-3-yl]-3-(4-methylphenyl)propanamide;hydrochloride (PubChem CID 119571395) has the molecular formula C18H30ClN3O2 and a molecular weight of 355.91 g/mol. Its IUPAC name is 3-acetamido-N-[3-(aminomethyl)pentan-3-yl]-3-(4-methylphenyl)propanamide;hydrochloride.
| Compound Name | 3-acetamido-N-[3-(aminomethyl)pentan-3-yl]-3-(4-methylphenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119571395 |
| Molecular Formula | C18H30ClN3O2 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 3-acetamido-N-[3-(aminomethyl)pentan-3-yl]-3-(4-methylphenyl)propanamide;hydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)CC(NC(C)=O)c1ccc(C)cc1.Cl |
| InChI | InChI=1S/C18H29N3O2.ClH/c1-5-18(6-2,12-19)21-17(23)11-16(20-14(4)22)15-9-7-13(3)8-10-15;/h7-10,16H,5-6,11-12,19H2,1-4H3,(H,20,22)(H,21,23);1H |
| InChIKey | SASYSEXFCISUGX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |