C14H23Cl2N3O — CID 119573018
N-(1-amino-2-cyclopropylpropan-2-yl)-2-pyridin-3-ylpropanamide;dihydrochloride (PubChem CID 119573018) has the molecular formula C14H23Cl2N3O and a molecular weight of 320.26 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-2-pyridin-3-ylpropanamide;dihydrochloride.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-2-pyridin-3-ylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119573018 |
| Molecular Formula | C14H23Cl2N3O |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-2-pyridin-3-ylpropanamide;dihydrochloride |
| SMILES | CC(C(=O)NC(C)(CN)C1CC1)c1cccnc1.Cl.Cl |
| InChI | InChI=1S/C14H21N3O.2ClH/c1-10(11-4-3-7-16-8-11)13(18)17-14(2,9-15)12-5-6-12;;/h3-4,7-8,10,12H,5-6,9,15H2,1-2H3,(H,17,18);2*1H |
| InChIKey | KPMIITJAJIDQQB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |