About N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide
N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 11957302) has the molecular formula C12H14N4O
and a molecular weight of 230.27 g/mol. Its IUPAC name is N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 11957302 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | C[C@H](NC(=O)Cn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C12H14N4O/c1-10(11-5-3-2-4-6-11)15-12(17)7-16-9-13-8-14-16/h2-6,8-10H,7H2,1H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | LNRQFWIFMYUWHB-JTQLQIEISA-N |
| XLogP | 1.16 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide?
The IUPAC name of N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide (CID 11957302) is N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide is C[C@H](NC(=O)Cn1cncn1)c1ccccc1.
What is the InChIKey of N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide?
The InChIKey is LNRQFWIFMYUWHB-JTQLQIEISA-N. The full InChI is InChI=1S/C12H14N4O/c1-10(11-5-3-2-4-6-11)15-12(17)7-16-9-13-8-14-16/h2-6,8-10H,7H2,1H3,(H,15,17)/t10-/m0/s1.
What are the key properties of N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide?
N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide has a molecular weight of 230.27 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-phenylethyl]-2-(1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 11957302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).