C22H26IN3O2 — CID 11957306
ethyl 2-[(E)-2-anilinoethenyl]-1,3-diethylbenzimidazol-1-ium-5-carboxylate iodide (PubChem CID 11957306) has the molecular formula C22H26IN3O2 and a molecular weight of 491.37 g/mol. Its IUPAC name is ethyl 2-[(E)-2-anilinoethenyl]-1,3-diethylbenzimidazol-1-ium-5-carboxylate iodide.
| Compound Name | ethyl 2-[(E)-2-anilinoethenyl]-1,3-diethylbenzimidazol-1-ium-5-carboxylate iodide |
|---|---|
| PubChem CID | 11957306 |
| Molecular Formula | C22H26IN3O2 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | ethyl 2-[(E)-2-anilinoethenyl]-1,3-diethylbenzimidazol-1-ium-5-carboxylate iodide |
| SMILES | CCOC(=O)c1ccc2c(c1)n(CC)c(/C=C/Nc1ccccc1)[n+]2CC.[I-] |
| InChI | InChI=1S/C22H25N3O2.HI/c1-4-24-19-13-12-17(22(26)27-6-3)16-20(19)25(5-2)21(24)14-15-23-18-10-8-7-9-11-18;/h7-16H,4-6H2,1-3H3;1H |
| InChIKey | BGSWCXPEEFOGDH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|