About [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride
[2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride (PubChem CID 11957313) has the molecular formula C23H26ClNO2
and a molecular weight of 383.92 g/mol. Its IUPAC name is [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride |
| PubChem CID | 11957313 |
| Molecular Formula | C23H26ClNO2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride |
| SMILES | Cc1ccc(-c2ncccc2OC(=O)C23CC4CC(CC(C4)C2)C3)cc1.Cl |
| InChI | InChI=1S/C23H25NO2.ClH/c1-15-4-6-19(7-5-15)21-20(3-2-8-24-21)26-22(25)23-12-16-9-17(13-23)11-18(10-16)14-23;/h2-8,16-18H,9-14H2,1H3;1H |
| InChIKey | YCPCDCHMTQVASB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride?
The IUPAC name of [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride (CID 11957313) is [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride.
What is the SMILES notation for [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride?
The canonical SMILES for [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride is Cc1ccc(-c2ncccc2OC(=O)C23CC4CC(CC(C4)C2)C3)cc1.Cl.
What is the InChIKey of [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride?
The InChIKey is YCPCDCHMTQVASB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO2.ClH/c1-15-4-6-19(7-5-15)21-20(3-2-8-24-21)26-22(25)23-12-16-9-17(13-23)11-18(10-16)14-23;/h2-8,16-18H,9-14H2,1H3;1H.
What are the key properties of [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride?
[2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride has a molecular weight of 383.92 g/mol, XLogP of 5.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride is sourced from PubChem (CID 11957313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).