About 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide
4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide (PubChem CID 11957315) has the molecular formula C15H21BrN2O
and a molecular weight of 325.25 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide |
| PubChem CID | 11957315 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide |
| SMILES | COc1ccc(C2(C#N)CC[N+](C)(C)CC2)cc1.[Br-] |
| InChI | InChI=1S/C15H21N2O.BrH/c1-17(2)10-8-15(12-16,9-11-17)13-4-6-14(18-3)7-5-13;/h4-7H,8-11H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | DIVMFNGCLDEAIT-UHFFFAOYSA-M |
| XLogP | -0.67 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide?
The IUPAC name of 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide (CID 11957315) is 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide.
What is the SMILES notation for 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide?
The canonical SMILES for 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide is COc1ccc(C2(C#N)CC[N+](C)(C)CC2)cc1.[Br-].
What is the InChIKey of 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide?
The InChIKey is DIVMFNGCLDEAIT-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H21N2O.BrH/c1-17(2)10-8-15(12-16,9-11-17)13-4-6-14(18-3)7-5-13;/h4-7H,8-11H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide?
4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide has a molecular weight of 325.25 g/mol, XLogP of -0.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-1,1-dimethylpiperidin-1-ium-4-carbonitrile bromide is sourced from PubChem (CID 11957315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).