C20H25N3O — CID 119575448
N-(1-amino-2-cyclopropylpropan-2-yl)-2-cyclopropyl-6-methylquinoline-4-carboxamide (PubChem CID 119575448) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-2-cyclopropyl-6-methylquinoline-4-carboxamide.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-2-cyclopropyl-6-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 119575448 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-2-cyclopropyl-6-methylquinoline-4-carboxamide |
| SMILES | Cc1ccc2nc(C3CC3)cc(C(=O)NC(C)(CN)C3CC3)c2c1 |
| InChI | InChI=1S/C20H25N3O/c1-12-3-8-17-15(9-12)16(10-18(22-17)13-4-5-13)19(24)23-20(2,11-21)14-6-7-14/h3,8-10,13-14H,4-7,11,21H2,1-2H3,(H,23,24) |
| InChIKey | AJVIFEYRHYZGTB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |