About N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride
N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 119575714) has the molecular formula C16H21Cl2N3OS
and a molecular weight of 374.34 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride.
Molecular Properties
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride |
| PubChem CID | 119575714 |
| Molecular Formula | C16H21Cl2N3OS |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | CC(CN)(NC(=O)c1csc(-c2ccccc2)n1)C1CC1.Cl.Cl |
| InChI | InChI=1S/C16H19N3OS.2ClH/c1-16(10-17,12-7-8-12)19-14(20)13-9-21-15(18-13)11-5-3-2-4-6-11;;/h2-6,9,12H,7-8,10,17H2,1H3,(H,19,20);2*1H |
| InChIKey | QEXZSDOOVQWLMR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride?
The IUPAC name of N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride (CID 119575714) is N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride.
What is the SMILES notation for N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride?
The canonical SMILES for N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride is CC(CN)(NC(=O)c1csc(-c2ccccc2)n1)C1CC1.Cl.Cl.
What is the InChIKey of N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride?
The InChIKey is QEXZSDOOVQWLMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3OS.2ClH/c1-16(10-17,12-7-8-12)19-14(20)13-9-21-15(18-13)11-5-3-2-4-6-11;;/h2-6,9,12H,7-8,10,17H2,1H3,(H,19,20);2*1H.
What are the key properties of N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride?
N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride has a molecular weight of 374.34 g/mol, XLogP of 3.51, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-2-cyclopropylpropan-2-yl)-2-phenyl-1,3-thiazole-4-carboxamide;dihydrochloride is sourced from PubChem (CID 119575714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).