About 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide
1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide (PubChem CID 11957611) has the molecular formula C13H22INO
and a molecular weight of 335.23 g/mol. Its IUPAC name is 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide.
Molecular Properties
| Compound Name | 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide |
| PubChem CID | 11957611 |
| Molecular Formula | C13H22INO |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide |
| SMILES | Cc1cccc(C)c1OCC(N)C(C)C.I |
| InChI | InChI=1S/C13H21NO.HI/c1-9(2)12(14)8-15-13-10(3)6-5-7-11(13)4;/h5-7,9,12H,8,14H2,1-4H3;1H |
| InChIKey | AQLAXCGHPBMFIJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide?
The IUPAC name of 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide (CID 11957611) is 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide.
What is the SMILES notation for 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide?
The canonical SMILES for 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide is Cc1cccc(C)c1OCC(N)C(C)C.I.
What is the InChIKey of 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide?
The InChIKey is AQLAXCGHPBMFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO.HI/c1-9(2)12(14)8-15-13-10(3)6-5-7-11(13)4;/h5-7,9,12H,8,14H2,1-4H3;1H.
What are the key properties of 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide?
1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide has a molecular weight of 335.23 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethylphenoxy)-3-methylbutan-2-amine;hydroiodide is sourced from PubChem (CID 11957611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).