About (2S,3R)-piperidine-2,3-dicarboxylic acid
(2S,3R)-piperidine-2,3-dicarboxylic acid (PubChem CID 11957663) has the molecular formula C7H11NO4
and a molecular weight of 173.17 g/mol. Its IUPAC name is (2S,3R)-piperidine-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | (2S,3R)-piperidine-2,3-dicarboxylic acid |
| PubChem CID | 11957663 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | (2S,3R)-piperidine-2,3-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1NCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C7H11NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h4-5,8H,1-3H2,(H,9,10)(H,11,12)/t4-,5+/m1/s1 |
| InChIKey | PTLWNCBCBZZBJI-UHNVWZDZSA-N |
| XLogP | -0.48 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3R)-piperidine-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-piperidine-2,3-dicarboxylic acid?
The IUPAC name of (2S,3R)-piperidine-2,3-dicarboxylic acid (CID 11957663) is (2S,3R)-piperidine-2,3-dicarboxylic acid.
What is the SMILES notation for (2S,3R)-piperidine-2,3-dicarboxylic acid?
The canonical SMILES for (2S,3R)-piperidine-2,3-dicarboxylic acid is O=C(O)[C@H]1NCCC[C@H]1C(=O)O.
What is the InChIKey of (2S,3R)-piperidine-2,3-dicarboxylic acid?
The InChIKey is PTLWNCBCBZZBJI-UHNVWZDZSA-N. The full InChI is InChI=1S/C7H11NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h4-5,8H,1-3H2,(H,9,10)(H,11,12)/t4-,5+/m1/s1.
What are the key properties of (2S,3R)-piperidine-2,3-dicarboxylic acid?
(2S,3R)-piperidine-2,3-dicarboxylic acid has a molecular weight of 173.17 g/mol, XLogP of -0.48, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-piperidine-2,3-dicarboxylic acid is sourced from PubChem (CID 11957663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).