C23H29NO6 — CID 11957700
(2S)-1-(2-ethylphenoxy)-3-[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]propan-2-ol;oxalic acid (PubChem CID 11957700) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is (2S)-1-(2-ethylphenoxy)-3-[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]propan-2-ol;oxalic acid.
| Compound Name | (2S)-1-(2-ethylphenoxy)-3-[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 11957700 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (2S)-1-(2-ethylphenoxy)-3-[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]propan-2-ol;oxalic acid |
| SMILES | CCc1ccccc1OC[C@@H](O)CN[C@H]1CCc2ccccc2C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H27NO2.C2H2O4/c1-2-16-7-5-6-10-21(16)24-15-20(23)14-22-19-12-11-17-8-3-4-9-18(17)13-19;3-1(4)2(5)6/h3-10,19-20,22-23H,2,11-15H2,1H3;(H,3,4)(H,5,6)/t19-,20-;/m0./s1 |
| InChIKey | HTEVEFDMFBMFEI-FKLPMGAJSA-N |
| XLogP | 2.29 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|