C21H31NO6 — CID 11957713
(Z)-but-2-enedioic acid;5,6-dimethoxy-N,N-dipropyl-2,3-dihydro-1H-inden-2-amine (PubChem CID 11957713) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;5,6-dimethoxy-N,N-dipropyl-2,3-dihydro-1H-inden-2-amine.
| Compound Name | (Z)-but-2-enedioic acid;5,6-dimethoxy-N,N-dipropyl-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 11957713 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;5,6-dimethoxy-N,N-dipropyl-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCCN(CCC)C1Cc2cc(OC)c(OC)cc2C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H27NO2.C4H4O4/c1-5-7-18(8-6-2)15-9-13-11-16(19-3)17(20-4)12-14(13)10-15;5-3(6)1-2-4(7)8/h11-12,15H,5-10H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | FSIQDESGRQTFNN-BTJKTKAUSA-N |
| XLogP | 3.00 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|