C23H34Cl2N2O5S — CID 11957718
2-(3,4-dichlorophenyl)-N-methyl-N-[(5S,7R,8R)-7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl]acetamide;methanesulfonic acid (PubChem CID 11957718) has the molecular formula C23H34Cl2N2O5S and a molecular weight of 521.51 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-methyl-N-[(5S,7R,8R)-7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl]acetamide;methanesulfonic acid.
| Compound Name | 2-(3,4-dichlorophenyl)-N-methyl-N-[(5S,7R,8R)-7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl]acetamide;methanesulfonic acid |
|---|---|
| PubChem CID | 11957718 |
| Molecular Formula | C23H34Cl2N2O5S |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-methyl-N-[(5S,7R,8R)-7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl]acetamide;methanesulfonic acid |
| SMILES | CN(C(=O)Cc1ccc(Cl)c(Cl)c1)[C@@H]1CC[C@]2(CCCO2)C[C@H]1N1CCCC1.CS(=O)(=O)O |
| InChI | InChI=1S/C22H30Cl2N2O2.CH4O3S/c1-25(21(27)14-16-5-6-17(23)18(24)13-16)19-7-9-22(8-4-12-28-22)15-20(19)26-10-2-3-11-26;1-5(2,3)4/h5-6,13,19-20H,2-4,7-12,14-15H2,1H3;1H3,(H,2,3,4)/t19-,20-,22-;/m1./s1 |
| InChIKey | FHEZDPDAYTVKKG-XLTSWDRCSA-N |
| XLogP | 4.06 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|