C13H26ClN3O2 — CID 119577234
4-methyl-N-[2-(3-methylpiperazin-1-yl)-2-oxoethyl]pentanamide;hydrochloride (PubChem CID 119577234) has the molecular formula C13H26ClN3O2 and a molecular weight of 291.82 g/mol. Its IUPAC name is 4-methyl-N-[2-(3-methylpiperazin-1-yl)-2-oxoethyl]pentanamide;hydrochloride.
| Compound Name | 4-methyl-N-[2-(3-methylpiperazin-1-yl)-2-oxoethyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119577234 |
| Molecular Formula | C13H26ClN3O2 |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 4-methyl-N-[2-(3-methylpiperazin-1-yl)-2-oxoethyl]pentanamide;hydrochloride |
| SMILES | CC(C)CCC(=O)NCC(=O)N1CCNC(C)C1.Cl |
| InChI | InChI=1S/C13H25N3O2.ClH/c1-10(2)4-5-12(17)15-8-13(18)16-7-6-14-11(3)9-16;/h10-11,14H,4-9H2,1-3H3,(H,15,17);1H |
| InChIKey | LFBKNEZFFFQTJD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |