About N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride
N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride (PubChem CID 119577479) has the molecular formula C18H30ClN3O3S
and a molecular weight of 403.98 g/mol. Its IUPAC name is N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride |
| PubChem CID | 119577479 |
| Molecular Formula | C18H30ClN3O3S |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)N2CCNC(C)C2)cc1.Cl |
| InChI | InChI=1S/C18H29N3O3S.ClH/c1-4-21(5-2)25(23,24)17-9-6-16(7-10-17)8-11-18(22)20-13-12-19-15(3)14-20;/h6-7,9-10,15,19H,4-5,8,11-14H2,1-3H3;1H |
| InChIKey | VSHZWKWYBHHYLU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride?
The IUPAC name of N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride (CID 119577479) is N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride.
What is the SMILES notation for N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride?
The canonical SMILES for N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride is CCN(CC)S(=O)(=O)c1ccc(CCC(=O)N2CCNC(C)C2)cc1.Cl.
What is the InChIKey of N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride?
The InChIKey is VSHZWKWYBHHYLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O3S.ClH/c1-4-21(5-2)25(23,24)17-9-6-16(7-10-17)8-11-18(22)20-13-12-19-15(3)14-20;/h6-7,9-10,15,19H,4-5,8,11-14H2,1-3H3;1H.
What are the key properties of N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride?
N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride has a molecular weight of 403.98 g/mol, XLogP of 1.89, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4-[3-(3-methylpiperazin-1-yl)-3-oxopropyl]benzenesulfonamide;hydrochloride is sourced from PubChem (CID 119577479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).