About 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one
3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 11957773) has the molecular formula C21H17Cl2N3O
and a molecular weight of 398.29 g/mol. Its IUPAC name is 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one |
| PubChem CID | 11957773 |
| Molecular Formula | C21H17Cl2N3O |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | Cc1nc2c(c(-c3ccc(Cl)cc3Cl)c1CN)C(=O)N(c1ccccc1)C2 |
| InChI | InChI=1S/C21H17Cl2N3O/c1-12-16(10-24)19(15-8-7-13(22)9-17(15)23)20-18(25-12)11-26(21(20)27)14-5-3-2-4-6-14/h2-9H,10-11,24H2,1H3 |
| InChIKey | UBZAWPWRJAUSNK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one?
The IUPAC name of 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one (CID 11957773) is 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one.
What is the SMILES notation for 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one?
The canonical SMILES for 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one is Cc1nc2c(c(-c3ccc(Cl)cc3Cl)c1CN)C(=O)N(c1ccccc1)C2.
What is the InChIKey of 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one?
The InChIKey is UBZAWPWRJAUSNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17Cl2N3O/c1-12-16(10-24)19(15-8-7-13(22)9-17(15)23)20-18(25-12)11-26(21(20)27)14-5-3-2-4-6-14/h2-9H,10-11,24H2,1H3.
What are the key properties of 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one?
3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one has a molecular weight of 398.29 g/mol, XLogP of 4.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-4-(2,4-dichlorophenyl)-2-methyl-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one is sourced from PubChem (CID 11957773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).