C22H20F3N5O6S — CID 11957778
N-hydroxy-2-[6-(naphthalen-2-ylsulfonylamino)-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 11957778) has the molecular formula C22H20F3N5O6S and a molecular weight of 539.49 g/mol. Its IUPAC name is N-hydroxy-2-[6-(naphthalen-2-ylsulfonylamino)-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-hydroxy-2-[6-(naphthalen-2-ylsulfonylamino)-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11957778 |
| Molecular Formula | C22H20F3N5O6S |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | N-hydroxy-2-[6-(naphthalen-2-ylsulfonylamino)-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NO)c1cnc(N2CC3C(C2)C3NS(=O)(=O)c2ccc3ccccc3c2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H19N5O4S.C2HF3O2/c26-19(23-27)14-8-21-20(22-9-14)25-10-16-17(11-25)18(16)24-30(28,29)15-6-5-12-3-1-2-4-13(12)7-15;3-2(4,5)1(6)7/h1-9,16-18,24,27H,10-11H2,(H,23,26);(H,6,7) |
| InChIKey | DPGCVMVRRJCUOI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 161.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|