C16H20N4O3 — CID 119577791
1-[4-(3-methylpiperazine-1-carbonyl)phenyl]diazinane-3,6-dione (PubChem CID 119577791) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-[4-(3-methylpiperazine-1-carbonyl)phenyl]diazinane-3,6-dione.
| Compound Name | 1-[4-(3-methylpiperazine-1-carbonyl)phenyl]diazinane-3,6-dione |
|---|---|
| PubChem CID | 119577791 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-[4-(3-methylpiperazine-1-carbonyl)phenyl]diazinane-3,6-dione |
| SMILES | CC1CN(C(=O)c2ccc(N3NC(=O)CCC3=O)cc2)CCN1 |
| InChI | InChI=1S/C16H20N4O3/c1-11-10-19(9-8-17-11)16(23)12-2-4-13(5-3-12)20-15(22)7-6-14(21)18-20/h2-5,11,17H,6-10H2,1H3,(H,18,21) |
| InChIKey | WSSGQQPVUWWSOD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |