C16H30N4O2 — CID 119578508
3-(3-methylpiperazine-1-carbonyl)-N-(2-methylpropyl)piperidine-1-carboxamide (PubChem CID 119578508) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-(3-methylpiperazine-1-carbonyl)-N-(2-methylpropyl)piperidine-1-carboxamide.
| Compound Name | 3-(3-methylpiperazine-1-carbonyl)-N-(2-methylpropyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 119578508 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 3-(3-methylpiperazine-1-carbonyl)-N-(2-methylpropyl)piperidine-1-carboxamide |
| SMILES | CC(C)CNC(=O)N1CCCC(C(=O)N2CCNC(C)C2)C1 |
| InChI | InChI=1S/C16H30N4O2/c1-12(2)9-18-16(22)20-7-4-5-14(11-20)15(21)19-8-6-17-13(3)10-19/h12-14,17H,4-11H2,1-3H3,(H,18,22) |
| InChIKey | RYPGRKOHSWAYGF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |