C11H19NO2 — CID 11957863
(2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol (PubChem CID 11957863) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol.
| Compound Name | (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 11957863 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol |
| SMILES | COC1C=CC(C[C@H](O)[C@H](C)N)C=C1 |
| InChI | InChI=1S/C11H19NO2/c1-8(12)11(13)7-9-3-5-10(14-2)6-4-9/h3-6,8-11,13H,7,12H2,1-2H3/t8-,9?,10?,11-/m0/s1 |
| InChIKey | OTPNPVPXZWIHQT-PMUOWJKOSA-N |
| XLogP | 0.84 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|