About (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol
(2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol (PubChem CID 11957863) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol.
Molecular Properties
| Compound Name | (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol |
| PubChem CID | 11957863 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol |
| SMILES | COC1C=CC(C[C@H](O)[C@H](C)N)C=C1 |
| InChI | InChI=1S/C11H19NO2/c1-8(12)11(13)7-9-3-5-10(14-2)6-4-9/h3-6,8-11,13H,7,12H2,1-2H3/t8-,9?,10?,11-/m0/s1 |
| InChIKey | OTPNPVPXZWIHQT-PMUOWJKOSA-N |
| XLogP | 0.84 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol?
The IUPAC name of (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol (CID 11957863) is (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol.
What is the SMILES notation for (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol?
The canonical SMILES for (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol is COC1C=CC(C[C@H](O)[C@H](C)N)C=C1.
What is the InChIKey of (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol?
The InChIKey is OTPNPVPXZWIHQT-PMUOWJKOSA-N. The full InChI is InChI=1S/C11H19NO2/c1-8(12)11(13)7-9-3-5-10(14-2)6-4-9/h3-6,8-11,13H,7,12H2,1-2H3/t8-,9?,10?,11-/m0/s1.
What are the key properties of (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol?
(2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol has a molecular weight of 197.28 g/mol, XLogP of 0.84, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-amino-1-(4-methoxycyclohexa-2,5-dien-1-yl)butan-2-ol is sourced from PubChem (CID 11957863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).