C13H16ClF3N2O2 — CID 119579326
(3-methylpiperazin-1-yl)-[4-(trifluoromethoxy)phenyl]methanone;hydrochloride (PubChem CID 119579326) has the molecular formula C13H16ClF3N2O2 and a molecular weight of 324.73 g/mol. Its IUPAC name is (3-methylpiperazin-1-yl)-[4-(trifluoromethoxy)phenyl]methanone;hydrochloride.
| Compound Name | (3-methylpiperazin-1-yl)-[4-(trifluoromethoxy)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119579326 |
| Molecular Formula | C13H16ClF3N2O2 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (3-methylpiperazin-1-yl)-[4-(trifluoromethoxy)phenyl]methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2ccc(OC(F)(F)F)cc2)CCN1.Cl |
| InChI | InChI=1S/C13H15F3N2O2.ClH/c1-9-8-18(7-6-17-9)12(19)10-2-4-11(5-3-10)20-13(14,15)16;/h2-5,9,17H,6-8H2,1H3;1H |
| InChIKey | OHSGQMOZXWFEMB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |