C33H40O4Si — CID 11958139
(3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-(trityloxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 11958139) has the molecular formula C33H40O4Si and a molecular weight of 528.77 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-(trityloxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-(trityloxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 11958139 |
| Molecular Formula | C33H40O4Si |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | (3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-(trityloxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2OC(=O)C[C@@H]2[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H40O4Si/c1-32(2,3)38(4,5)37-30-22-29-27(21-31(34)36-29)28(30)23-35-33(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,27-30H,21-23H2,1-5H3/t27-,28-,29+,30-/m1/s1 |
| InChIKey | HPQJSBPBJHOGAT-GKIKGMKOSA-N |
| XLogP | 7.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|