About chlorogold;tritert-butylphosphane
chlorogold;tritert-butylphosphane (PubChem CID 11958185) has the molecular formula C12H27AuClP
and a molecular weight of 434.74 g/mol. Its IUPAC name is chlorogold;tritert-butylphosphane.
Molecular Properties
| Compound Name | chlorogold;tritert-butylphosphane |
| PubChem CID | 11958185 |
| Molecular Formula | C12H27AuClP |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | chlorogold;tritert-butylphosphane |
| SMILES | CC(C)(C)P(C(C)(C)C)C(C)(C)C.Cl[Au] |
| InChI | InChI=1S/C12H27P.Au.ClH/c1-10(2,3)13(11(4,5)6)12(7,8)9;;/h1-9H3;;1H/q;+1;/p-1 |
| InChIKey | JLXSZGSXDDQSJF-UHFFFAOYSA-M |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chlorogold;tritert-butylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorogold;tritert-butylphosphane?
The IUPAC name of chlorogold;tritert-butylphosphane (CID 11958185) is chlorogold;tritert-butylphosphane.
What is the SMILES notation for chlorogold;tritert-butylphosphane?
The canonical SMILES for chlorogold;tritert-butylphosphane is CC(C)(C)P(C(C)(C)C)C(C)(C)C.Cl[Au].
What is the InChIKey of chlorogold;tritert-butylphosphane?
The InChIKey is JLXSZGSXDDQSJF-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H27P.Au.ClH/c1-10(2,3)13(11(4,5)6)12(7,8)9;;/h1-9H3;;1H/q;+1;/p-1.
What are the key properties of chlorogold;tritert-butylphosphane?
chlorogold;tritert-butylphosphane has a molecular weight of 434.74 g/mol, XLogP of 5.55, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorogold;tritert-butylphosphane is sourced from PubChem (CID 11958185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).