C20H30O8 — CID 11958274
propan-2-yl (3R)-2-oxo-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]hex-5-enoate (PubChem CID 11958274) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is propan-2-yl (3R)-2-oxo-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]hex-5-enoate.
| Compound Name | propan-2-yl (3R)-2-oxo-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]hex-5-enoate |
|---|---|
| PubChem CID | 11958274 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | propan-2-yl (3R)-2-oxo-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]hex-5-enoate |
| SMILES | C=CC[C@@H](C(=O)C(=O)OC(C)C)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C20H30O8/c1-8-9-11(12(21)17(22)23-10(2)3)13-14-15(26-19(4,5)25-14)16-18(24-13)28-20(6,7)27-16/h8,10-11,13-16,18H,1,9H2,2-7H3/t11-,13+,14-,15-,16+,18+/m0/s1 |
| InChIKey | KXENCYUADYFPGJ-UBMWINGVSA-N |
| XLogP | 2.10 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|