C11H16N4O3 — CID 119583999
N-(1-aminopropan-2-yl)-N,2-dimethyl-5-nitropyridine-3-carboxamide (PubChem CID 119583999) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N,2-dimethyl-5-nitropyridine-3-carboxamide.
| Compound Name | N-(1-aminopropan-2-yl)-N,2-dimethyl-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 119583999 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N,2-dimethyl-5-nitropyridine-3-carboxamide |
| SMILES | Cc1ncc([N+](=O)[O-])cc1C(=O)N(C)C(C)CN |
| InChI | InChI=1S/C11H16N4O3/c1-7(5-12)14(3)11(16)10-4-9(15(17)18)6-13-8(10)2/h4,6-7H,5,12H2,1-3H3 |
| InChIKey | PEMDUQCFXYWQHX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|