C19H19N3O4 — CID 11958405
N-(1,3-benzodioxol-5-ylmethyl)-3-ethoxy-2-methylindazole-6-carboxamide (PubChem CID 11958405) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-ethoxy-2-methylindazole-6-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-ethoxy-2-methylindazole-6-carboxamide |
|---|---|
| PubChem CID | 11958405 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-ethoxy-2-methylindazole-6-carboxamide |
| SMILES | CCOc1c2ccc(C(=O)NCc3ccc4c(c3)OCO4)cc2nn1C |
| InChI | InChI=1S/C19H19N3O4/c1-3-24-19-14-6-5-13(9-15(14)21-22(19)2)18(23)20-10-12-4-7-16-17(8-12)26-11-25-16/h4-9H,3,10-11H2,1-2H3,(H,20,23) |
| InChIKey | VSKXDVVFEUDKDM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |