C14H21Cl3N2O2 — CID 119584124
N-(1-aminopropan-2-yl)-4-(2,3-dichlorophenoxy)-N-methylbutanamide;hydrochloride (PubChem CID 119584124) has the molecular formula C14H21Cl3N2O2 and a molecular weight of 355.69 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-4-(2,3-dichlorophenoxy)-N-methylbutanamide;hydrochloride.
| Compound Name | N-(1-aminopropan-2-yl)-4-(2,3-dichlorophenoxy)-N-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119584124 |
| Molecular Formula | C14H21Cl3N2O2 |
| Molecular Weight | 355.69 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-(1-aminopropan-2-yl)-4-(2,3-dichlorophenoxy)-N-methylbutanamide;hydrochloride |
| SMILES | CC(CN)N(C)C(=O)CCCOc1cccc(Cl)c1Cl.Cl |
| InChI | InChI=1S/C14H20Cl2N2O2.ClH/c1-10(9-17)18(2)13(19)7-4-8-20-12-6-3-5-11(15)14(12)16;/h3,5-6,10H,4,7-9,17H2,1-2H3;1H |
| InChIKey | GYRQXYXLUMZWTL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|