About N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide (PubChem CID 11958424) has the molecular formula C22H21F6N3O2
and a molecular weight of 473.42 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide.
Molecular Properties
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide |
| PubChem CID | 11958424 |
| Molecular Formula | C22H21F6N3O2 |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide |
| SMILES | CCCCn1nc2cc(C(=O)NCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2c1OC |
| InChI | InChI=1S/C22H21F6N3O2/c1-3-4-7-31-20(33-2)17-6-5-14(10-18(17)30-31)19(32)29-12-13-8-15(21(23,24)25)11-16(9-13)22(26,27)28/h5-6,8-11H,3-4,7,12H2,1-2H3,(H,29,32) |
| InChIKey | OERQCPUSQKLWFE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide?
The IUPAC name of N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide (CID 11958424) is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide.
What is the SMILES notation for N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide?
The canonical SMILES for N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide is CCCCn1nc2cc(C(=O)NCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2c1OC.
What is the InChIKey of N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide?
The InChIKey is OERQCPUSQKLWFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F6N3O2/c1-3-4-7-31-20(33-2)17-6-5-14(10-18(17)30-31)19(32)29-12-13-8-15(21(23,24)25)11-16(9-13)22(26,27)28/h5-6,8-11H,3-4,7,12H2,1-2H3,(H,29,32).
What are the key properties of N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide?
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide has a molecular weight of 473.42 g/mol, XLogP of 5.81, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-butyl-3-methoxyindazole-6-carboxamide is sourced from PubChem (CID 11958424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).