C18H20FN3O4S — CID 11958465
3-[(4-fluorophenyl)sulfanylmethyl]-4-N-(2-methoxyethyl)-5-N-prop-2-enyl-1,2-oxazole-4,5-dicarboxamide (PubChem CID 11958465) has the molecular formula C18H20FN3O4S and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfanylmethyl]-4-N-(2-methoxyethyl)-5-N-prop-2-enyl-1,2-oxazole-4,5-dicarboxamide.
| Compound Name | 3-[(4-fluorophenyl)sulfanylmethyl]-4-N-(2-methoxyethyl)-5-N-prop-2-enyl-1,2-oxazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 11958465 |
| Molecular Formula | C18H20FN3O4S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfanylmethyl]-4-N-(2-methoxyethyl)-5-N-prop-2-enyl-1,2-oxazole-4,5-dicarboxamide |
| SMILES | C=CCNC(=O)c1onc(CSc2ccc(F)cc2)c1C(=O)NCCOC |
| InChI | InChI=1S/C18H20FN3O4S/c1-3-8-20-18(24)16-15(17(23)21-9-10-25-2)14(22-26-16)11-27-13-6-4-12(19)5-7-13/h3-7H,1,8-11H2,2H3,(H,20,24)(H,21,23) |
| InChIKey | KKKWIPVRWPEFOH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|