C19H21ClN4OS2 — CID 11958492
N-[5-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]hexanamide (PubChem CID 11958492) has the molecular formula C19H21ClN4OS2 and a molecular weight of 420.99 g/mol. Its IUPAC name is N-[5-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]hexanamide.
| Compound Name | N-[5-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 11958492 |
| Molecular Formula | C19H21ClN4OS2 |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-[5-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1nc(C)c(-c2csc(Nc3ccc(Cl)cc3)n2)s1 |
| InChI | InChI=1S/C19H21ClN4OS2/c1-3-4-5-6-16(25)24-19-21-12(2)17(27-19)15-11-26-18(23-15)22-14-9-7-13(20)8-10-14/h7-11H,3-6H2,1-2H3,(H,22,23)(H,21,24,25) |
| InChIKey | WBPYTLUIAMQXCF-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|