C26H29FN4O4S — CID 11958508
5-N-benzyl-3-[(4-fluorophenyl)sulfanylmethyl]-4-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-4,5-dicarboxamide (PubChem CID 11958508) has the molecular formula C26H29FN4O4S and a molecular weight of 512.61 g/mol. Its IUPAC name is 5-N-benzyl-3-[(4-fluorophenyl)sulfanylmethyl]-4-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-4,5-dicarboxamide.
| Compound Name | 5-N-benzyl-3-[(4-fluorophenyl)sulfanylmethyl]-4-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 11958508 |
| Molecular Formula | C26H29FN4O4S |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 5-N-benzyl-3-[(4-fluorophenyl)sulfanylmethyl]-4-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-4,5-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1onc(CSc2ccc(F)cc2)c1C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C26H29FN4O4S/c27-20-7-9-21(10-8-20)36-18-22-23(25(32)28-11-4-12-31-13-15-34-16-14-31)24(35-30-22)26(33)29-17-19-5-2-1-3-6-19/h1-3,5-10H,4,11-18H2,(H,28,32)(H,29,33) |
| InChIKey | BRIMTFFLMPTKAT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|